C30H41BrO5 — CID 25188969
methyl 2-bromo-2-[(2S,5S,6S)-5-methyl-6-[(2S,3S,4S)-4-methyl-3,5-bis(phenylmethoxy)pentan-2-yl]oxan-2-yl]propanoate (PubChem CID 25188969) has the molecular formula C30H41BrO5 and a molecular weight of 561.56 g/mol. Its IUPAC name is methyl 2-bromo-2-[(2S,5S,6S)-5-methyl-6-[(2S,3S,4S)-4-methyl-3,5-bis(phenylmethoxy)pentan-2-yl]oxan-2-yl]propanoate.
| Compound Name | methyl 2-bromo-2-[(2S,5S,6S)-5-methyl-6-[(2S,3S,4S)-4-methyl-3,5-bis(phenylmethoxy)pentan-2-yl]oxan-2-yl]propanoate |
|---|---|
| PubChem CID | 25188969 |
| Molecular Formula | C30H41BrO5 |
| Molecular Weight | 561.56 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | methyl 2-bromo-2-[(2S,5S,6S)-5-methyl-6-[(2S,3S,4S)-4-methyl-3,5-bis(phenylmethoxy)pentan-2-yl]oxan-2-yl]propanoate |
| SMILES | COC(=O)C(C)(Br)[C@@H]1CC[C@H](C)[C@@H]([C@@H](C)[C@@H](OCc2ccccc2)[C@@H](C)COCc2ccccc2)O1 |
| InChI | InChI=1S/C30H41BrO5/c1-21-16-17-26(30(4,31)29(32)33-5)36-28(21)23(3)27(35-20-25-14-10-7-11-15-25)22(2)18-34-19-24-12-8-6-9-13-24/h6-15,21-23,26-28H,16-20H2,1-5H3/t21-,22-,23-,26-,27-,28-,30?/m0/s1 |
| InChIKey | IYFAYUHUQCUEPL-FKFZKVMUSA-N |
| XLogP | 6.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|