About (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide
(2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide (PubChem CID 25358585) has the molecular formula C17H25N5O3
and a molecular weight of 347.42 g/mol. Its IUPAC name is (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide.
Molecular Properties
| Compound Name | (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide |
| PubChem CID | 25358585 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide |
| SMILES | C[C@@H](C(=O)NC1CCCCCC1)n1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C17H25N5O3/c1-11(15(23)19-12-8-6-4-5-7-9-12)22-16(24)13-14(18-10-20(13)2)21(3)17(22)25/h10-12H,4-9H2,1-3H3,(H,19,23)/t11-/m0/s1 |
| InChIKey | FNHCJHZUNTUIOH-NSHDSACASA-N |
| XLogP | 0.83 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide?
The IUPAC name of (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide (CID 25358585) is (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide.
What is the SMILES notation for (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide?
The canonical SMILES for (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide is C[C@@H](C(=O)NC1CCCCCC1)n1c(=O)c2c(ncn2C)n(C)c1=O.
What is the InChIKey of (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide?
The InChIKey is FNHCJHZUNTUIOH-NSHDSACASA-N. The full InChI is InChI=1S/C17H25N5O3/c1-11(15(23)19-12-8-6-4-5-7-9-12)22-16(24)13-14(18-10-20(13)2)21(3)17(22)25/h10-12H,4-9H2,1-3H3,(H,19,23)/t11-/m0/s1.
What are the key properties of (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide?
(2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide has a molecular weight of 347.42 g/mol, XLogP of 0.83, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide is sourced from PubChem (CID 25358585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).