C17H25N5O3 — CID 25358585
(2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide (PubChem CID 25358585) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide.
| Compound Name | (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide |
|---|---|
| PubChem CID | 25358585 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (2S)-N-cycloheptyl-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)propanamide |
| SMILES | C[C@@H](C(=O)NC1CCCCCC1)n1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C17H25N5O3/c1-11(15(23)19-12-8-6-4-5-7-9-12)22-16(24)13-14(18-10-20(13)2)21(3)17(22)25/h10-12H,4-9H2,1-3H3,(H,19,23)/t11-/m0/s1 |
| InChIKey | FNHCJHZUNTUIOH-NSHDSACASA-N |
| XLogP | 0.83 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |