C15H11BrN2O3 — CID 26860691
4-[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 26860691) has the molecular formula C15H11BrN2O3 and a molecular weight of 347.17 g/mol. Its IUPAC name is 4-[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 26860691 |
| Molecular Formula | C15H11BrN2O3 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 4-[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)/C=C/c2ccc(Br)o2)c2ccccc2N1 |
| InChI | InChI=1S/C15H11BrN2O3/c16-13-7-5-10(21-13)6-8-15(20)18-9-14(19)17-11-3-1-2-4-12(11)18/h1-8H,9H2,(H,17,19)/b8-6+ |
| InChIKey | CCIGBQRXMKZBHU-SOFGYWHQSA-N |
| XLogP | 3.04 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|