C17H12Cl2F6N2O3 — CID 2726180
1-[3,5-bis(trifluoromethyl)phenyl]-3-(3,5-dichloro-2,6-dimethoxyphenyl)urea (PubChem CID 2726180) has the molecular formula C17H12Cl2F6N2O3 and a molecular weight of 477.19 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3,5-dichloro-2,6-dimethoxyphenyl)urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3,5-dichloro-2,6-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 2726180 |
| Molecular Formula | C17H12Cl2F6N2O3 |
| Molecular Weight | 477.19 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(3,5-dichloro-2,6-dimethoxyphenyl)urea |
| SMILES | COc1c(Cl)cc(Cl)c(OC)c1NC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12Cl2F6N2O3/c1-29-13-10(18)6-11(19)14(30-2)12(13)27-15(28)26-9-4-7(16(20,21)22)3-8(5-9)17(23,24)25/h3-6H,1-2H3,(H2,26,27,28) |
| InChIKey | HBPQKVVZIJFGKX-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.19 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |