C10H9ClN2O3 — CID 2726310
(5-chloro-1,2-benzoxazol-3-yl) N,N-dimethylcarbamate (PubChem CID 2726310) has the molecular formula C10H9ClN2O3 and a molecular weight of 240.65 g/mol. Its IUPAC name is (5-chloro-1,2-benzoxazol-3-yl) N,N-dimethylcarbamate.
| Compound Name | (5-chloro-1,2-benzoxazol-3-yl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 2726310 |
| Molecular Formula | C10H9ClN2O3 |
| Molecular Weight | 240.65 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | (5-chloro-1,2-benzoxazol-3-yl) N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1noc2ccc(Cl)cc12 |
| InChI | InChI=1S/C10H9ClN2O3/c1-13(2)10(14)15-9-7-5-6(11)3-4-8(7)16-12-9/h3-5H,1-2H3 |
| InChIKey | FRBDVDNNCKLJFZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.65 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |