C21H22ClN3O5S2 — CID 27669119
4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 27669119) has the molecular formula C21H22ClN3O5S2 and a molecular weight of 496.01 g/mol. Its IUPAC name is 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 27669119 |
| Molecular Formula | C21H22ClN3O5S2 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCOc1ccc(-c2csc(NC(=O)c3ccc(Cl)c(S(=O)(=O)N(C)OC)c3)n2)cc1 |
| InChI | InChI=1S/C21H22ClN3O5S2/c1-4-11-30-16-8-5-14(6-9-16)18-13-31-21(23-18)24-20(26)15-7-10-17(22)19(12-15)32(27,28)25(2)29-3/h5-10,12-13H,4,11H2,1-3H3,(H,23,24,26) |
| InChIKey | DDHIXZQAHSENNT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|