C5HF9O — CID 2769667
2,2,3,3,4,4,5,5,5-nonafluoropentanal (PubChem CID 2769667) has the molecular formula C5HF9O and a molecular weight of 248.04 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoropentanal.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoropentanal |
|---|---|
| PubChem CID | 2769667 |
| Molecular Formula | C5HF9O |
| Molecular Weight | 248.04 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoropentanal |
| SMILES | O=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5HF9O/c6-2(7,1-15)3(8,9)4(10,11)5(12,13)14/h1H |
| InChIKey | ILSWGKFIWBVLDG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.04 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|