C6H2F8O2 — CID 12751140
2,2,3,3,4,4,5,5-octafluorohexanedial (PubChem CID 12751140) has the molecular formula C6H2F8O2 and a molecular weight of 258.06 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluorohexanedial.
| Compound Name | 2,2,3,3,4,4,5,5-octafluorohexanedial |
|---|---|
| PubChem CID | 12751140 |
| Molecular Formula | C6H2F8O2 |
| Molecular Weight | 258.06 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluorohexanedial |
| SMILES | O=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C=O |
| InChI | InChI=1S/C6H2F8O2/c7-3(8,1-15)5(11,12)6(13,14)4(9,10)2-16/h1-2H |
| InChIKey | TVIFQQHBCGGHNL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.06 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|