C20H13Cl2FN4S — CID 2804366
1-(2-cyano-3-fluorophenyl)-3-(3,4-dichlorophenyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 2804366) has the molecular formula C20H13Cl2FN4S and a molecular weight of 431.32 g/mol. Its IUPAC name is 1-(2-cyano-3-fluorophenyl)-3-(3,4-dichlorophenyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-(2-cyano-3-fluorophenyl)-3-(3,4-dichlorophenyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2804366 |
| Molecular Formula | C20H13Cl2FN4S |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 1-(2-cyano-3-fluorophenyl)-3-(3,4-dichlorophenyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | N#Cc1c(F)cccc1N(Cc1cccnc1)C(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H13Cl2FN4S/c21-16-7-6-14(9-17(16)22)26-20(28)27(12-13-3-2-8-25-11-13)19-5-1-4-18(23)15(19)10-24/h1-9,11H,12H2,(H,26,28) |
| InChIKey | PYZKESKTGKTNID-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|