C9H9F3O5S2 — CID 2805966
[4-(trifluoromethyl)phenyl] methylsulfonylmethanesulfonate (PubChem CID 2805966) has the molecular formula C9H9F3O5S2 and a molecular weight of 318.29 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] methylsulfonylmethanesulfonate.
| Compound Name | [4-(trifluoromethyl)phenyl] methylsulfonylmethanesulfonate |
|---|---|
| PubChem CID | 2805966 |
| Molecular Formula | C9H9F3O5S2 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] methylsulfonylmethanesulfonate |
| SMILES | CS(=O)(=O)CS(=O)(=O)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H9F3O5S2/c1-18(13,14)6-19(15,16)17-8-4-2-7(3-5-8)9(10,11)12/h2-5H,6H2,1H3 |
| InChIKey | BSLJQYACQWJYDV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|