C19H18N4O3S — CID 2807331
1-(1,3-benzodioxol-5-ylmethylideneamino)-1-(2-cyanoethyl)-3-(3-methoxyphenyl)thiourea (PubChem CID 2807331) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethylideneamino)-1-(2-cyanoethyl)-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethylideneamino)-1-(2-cyanoethyl)-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 2807331 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethylideneamino)-1-(2-cyanoethyl)-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)N(CCC#N)N=Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C19H18N4O3S/c1-24-16-5-2-4-15(11-16)22-19(27)23(9-3-8-20)21-12-14-6-7-17-18(10-14)26-13-25-17/h2,4-7,10-12H,3,9,13H2,1H3,(H,22,27) |
| InChIKey | GWGRZEHACGTAFE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|