C16H16Cl2N4 — CID 2818859
(Z)-2-[(2,6-dichlorophenyl)methylideneamino]-3-(2,2-dimethylpropylamino)but-2-enedinitrile (PubChem CID 2818859) has the molecular formula C16H16Cl2N4 and a molecular weight of 335.24 g/mol. Its IUPAC name is (Z)-2-[(2,6-dichlorophenyl)methylideneamino]-3-(2,2-dimethylpropylamino)but-2-enedinitrile.
| Compound Name | (Z)-2-[(2,6-dichlorophenyl)methylideneamino]-3-(2,2-dimethylpropylamino)but-2-enedinitrile |
|---|---|
| PubChem CID | 2818859 |
| Molecular Formula | C16H16Cl2N4 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (Z)-2-[(2,6-dichlorophenyl)methylideneamino]-3-(2,2-dimethylpropylamino)but-2-enedinitrile |
| SMILES | CC(C)(C)CN/C(C#N)=C(C#N)\N=C\c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H16Cl2N4/c1-16(2,3)10-22-15(8-20)14(7-19)21-9-11-12(17)5-4-6-13(11)18/h4-6,9,22H,10H2,1-3H3/b15-14-,21-9+ |
| InChIKey | GOJZYLVOQXNXCJ-RXDWQSKCSA-N |
| XLogP | 4.31 |
| TPSA | 71.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|