C19H17NO4S — CID 2838197
2-piperidin-1-ylsulfonylanthracene-9,10-dione (PubChem CID 2838197) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-piperidin-1-ylsulfonylanthracene-9,10-dione.
| Compound Name | 2-piperidin-1-ylsulfonylanthracene-9,10-dione |
|---|---|
| PubChem CID | 2838197 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-piperidin-1-ylsulfonylanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C19H17NO4S/c21-18-14-6-2-3-7-15(14)19(22)17-12-13(8-9-16(17)18)25(23,24)20-10-4-1-5-11-20/h2-3,6-9,12H,1,4-5,10-11H2 |
| InChIKey | QLOWRQGENQBSNC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|