C16H21ClN2O3S — CID 28662112
(2R)-2-chloro-N-[6-(3-methoxy-3-methylbutoxy)-1,3-benzothiazol-2-yl]propanamide (PubChem CID 28662112) has the molecular formula C16H21ClN2O3S and a molecular weight of 356.88 g/mol. Its IUPAC name is (2R)-2-chloro-N-[6-(3-methoxy-3-methylbutoxy)-1,3-benzothiazol-2-yl]propanamide.
| Compound Name | (2R)-2-chloro-N-[6-(3-methoxy-3-methylbutoxy)-1,3-benzothiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 28662112 |
| Molecular Formula | C16H21ClN2O3S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (2R)-2-chloro-N-[6-(3-methoxy-3-methylbutoxy)-1,3-benzothiazol-2-yl]propanamide |
| SMILES | COC(C)(C)CCOc1ccc2nc(NC(=O)[C@@H](C)Cl)sc2c1 |
| InChI | InChI=1S/C16H21ClN2O3S/c1-10(17)14(20)19-15-18-12-6-5-11(9-13(12)23-15)22-8-7-16(2,3)21-4/h5-6,9-10H,7-8H2,1-4H3,(H,18,19,20)/t10-/m1/s1 |
| InChIKey | LZMKALXJODKIFE-SNVBAGLBSA-N |
| XLogP | 4.06 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|