C20H18F7N3O2S — CID 29037709
N-[(Z)-1-[4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]-5-propan-2-ylthiophene-3-carboxamide (PubChem CID 29037709) has the molecular formula C20H18F7N3O2S and a molecular weight of 497.44 g/mol. Its IUPAC name is N-[(Z)-1-[4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]-5-propan-2-ylthiophene-3-carboxamide.
| Compound Name | N-[(Z)-1-[4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]-5-propan-2-ylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 29037709 |
| Molecular Formula | C20H18F7N3O2S |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | N-[(Z)-1-[4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]-5-propan-2-ylthiophene-3-carboxamide |
| SMILES | C/C(=N/NC(=O)c1csc(C(C)C)c1)c1ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F7N3O2S/c1-10(2)15-8-13(9-33-15)16(31)30-29-11(3)12-4-6-14(7-5-12)28-17(32)18(21,22)19(23,24)20(25,26)27/h4-10H,1-3H3,(H,28,32)(H,30,31)/b29-11- |
| InChIKey | BJJBNRQFFCJMTO-KYMQWJLESA-N |
| XLogP | 5.80 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|