C18H11F3N2O6 — CID 2910312
N-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]-1-oxoisochromene-3-carboxamide (PubChem CID 2910312) has the molecular formula C18H11F3N2O6 and a molecular weight of 408.29 g/mol. Its IUPAC name is N-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]-1-oxoisochromene-3-carboxamide.
| Compound Name | N-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]-1-oxoisochromene-3-carboxamide |
|---|---|
| PubChem CID | 2910312 |
| Molecular Formula | C18H11F3N2O6 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | N-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]-1-oxoisochromene-3-carboxamide |
| SMILES | O=C(Nc1cc(OCC(F)(F)F)cc([N+](=O)[O-])c1)c1cc2ccccc2c(=O)o1 |
| InChI | InChI=1S/C18H11F3N2O6/c19-18(20,21)9-28-13-7-11(6-12(8-13)23(26)27)22-16(24)15-5-10-3-1-2-4-14(10)17(25)29-15/h1-8H,9H2,(H,22,24) |
| InChIKey | GBVJZSDDSJANJJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|