C34H45FN4O5S2 — CID 3006635
3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1-[(4-fluorophenyl)methyl]thiourea (PubChem CID 3006635) has the molecular formula C34H45FN4O5S2 and a molecular weight of 672.89 g/mol. Its IUPAC name is 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 3006635 |
| Molecular Formula | C34H45FN4O5S2 |
| Molecular Weight | 672.89 g/mol |
| Exact Mass | 672.28 |
| IUPAC Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1-[(4-fluorophenyl)methyl]thiourea |
| SMILES | CC(C)CCN([C@H](CO)CCCCNC(=S)N(Cc1ccc(F)cc1)Cc1ccc2c(c1)OCCO2)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C34H45FN4O5S2/c1-25(2)16-18-39(46(41,42)31-13-11-29(36)12-14-31)30(24-40)5-3-4-17-37-34(45)38(22-26-6-9-28(35)10-7-26)23-27-8-15-32-33(21-27)44-20-19-43-32/h6-15,21,25,30,40H,3-5,16-20,22-24,36H2,1-2H3,(H,37,45)/t30-/m0/s1 |
| InChIKey | BFUBIKTUZNMXLM-PMERELPUSA-N |
| XLogP | 5.32 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.89 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|