C16H15ClN4O2S2 — CID 30283978
2-[3-[2-(2-chlorophenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-yl]acetamide (PubChem CID 30283978) has the molecular formula C16H15ClN4O2S2 and a molecular weight of 394.91 g/mol. Its IUPAC name is 2-[3-[2-(2-chlorophenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-yl]acetamide.
| Compound Name | 2-[3-[2-(2-chlorophenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 30283978 |
| Molecular Formula | C16H15ClN4O2S2 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 2-[3-[2-(2-chlorophenoxy)ethylsulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-yl]acetamide |
| SMILES | NC(=O)Cn1c(SCCOc2ccccc2Cl)nnc1-c1cccs1 |
| InChI | InChI=1S/C16H15ClN4O2S2/c17-11-4-1-2-5-12(11)23-7-9-25-16-20-19-15(13-6-3-8-24-13)21(16)10-14(18)22/h1-6,8H,7,9-10H2,(H2,18,22) |
| InChIKey | JYCGZDYMLHPXHS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|