C20H27F3N2S — CID 3043039
11-(2-pyrrolidin-1-ylethyl)-2-(trifluoromethyl)-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzothiazine (PubChem CID 3043039) has the molecular formula C20H27F3N2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 11-(2-pyrrolidin-1-ylethyl)-2-(trifluoromethyl)-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzothiazine.
| Compound Name | 11-(2-pyrrolidin-1-ylethyl)-2-(trifluoromethyl)-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzothiazine |
|---|---|
| PubChem CID | 3043039 |
| Molecular Formula | C20H27F3N2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 11-(2-pyrrolidin-1-ylethyl)-2-(trifluoromethyl)-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzothiazine |
| SMILES | FC(F)(F)c1ccc2c(c1)N(CCN1CCCC1)C1CCCCCC1S2 |
| InChI | InChI=1S/C20H27F3N2S/c21-20(22,23)15-8-9-19-17(14-15)25(13-12-24-10-4-5-11-24)16-6-2-1-3-7-18(16)26-19/h8-9,14,16,18H,1-7,10-13H2 |
| InChIKey | JWFOAZABRHRDRW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |