C26H41N3O5S2 — CID 3083282
(2,5-dioxopyrrolidin-1-yl) 4-[6-[(2-methyl-2-sulfanylpropyl)amino]-5-[[(2-methyl-2-sulfanylpropyl)amino]methyl]hexoxy]benzoate (PubChem CID 3083282) has the molecular formula C26H41N3O5S2 and a molecular weight of 539.76 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[6-[(2-methyl-2-sulfanylpropyl)amino]-5-[[(2-methyl-2-sulfanylpropyl)amino]methyl]hexoxy]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[6-[(2-methyl-2-sulfanylpropyl)amino]-5-[[(2-methyl-2-sulfanylpropyl)amino]methyl]hexoxy]benzoate |
|---|---|
| PubChem CID | 3083282 |
| Molecular Formula | C26H41N3O5S2 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[6-[(2-methyl-2-sulfanylpropyl)amino]-5-[[(2-methyl-2-sulfanylpropyl)amino]methyl]hexoxy]benzoate |
| SMILES | CC(C)(S)CNCC(CCCCOc1ccc(C(=O)ON2C(=O)CCC2=O)cc1)CNCC(C)(C)S |
| InChI | InChI=1S/C26H41N3O5S2/c1-25(2,35)17-27-15-19(16-28-18-26(3,4)36)7-5-6-14-33-21-10-8-20(9-11-21)24(32)34-29-22(30)12-13-23(29)31/h8-11,19,27-28,35-36H,5-7,12-18H2,1-4H3 |
| InChIKey | JSPRJZXNZNNJBV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|