C15H13BrN2OS2 — CID 31840109
4-bromo-N,N-bis(thiophen-2-ylmethyl)-1H-pyrrole-2-carboxamide (PubChem CID 31840109) has the molecular formula C15H13BrN2OS2 and a molecular weight of 381.32 g/mol. Its IUPAC name is 4-bromo-N,N-bis(thiophen-2-ylmethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N,N-bis(thiophen-2-ylmethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 31840109 |
| Molecular Formula | C15H13BrN2OS2 |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | 4-bromo-N,N-bis(thiophen-2-ylmethyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(c1cc(Br)c[nH]1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C15H13BrN2OS2/c16-11-7-14(17-8-11)15(19)18(9-12-3-1-5-20-12)10-13-4-2-6-21-13/h1-8,17H,9-10H2 |
| InChIKey | BTNZOZFNZJPUQX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |