C19H22N3O4S+ — CID 3301678
2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 3301678) has the molecular formula C19H22N3O4S+ and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3301678 |
| Molecular Formula | C19H22N3O4S+ |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)CSc2[nH]c3ccccc3[n+]2C)cc(OC)c1OC |
| InChI | InChI=1S/C19H21N3O4S/c1-22-14-8-6-5-7-13(14)21-19(22)27-11-17(23)20-12-9-15(24-2)18(26-4)16(10-12)25-3/h5-10H,11H2,1-4H3,(H,20,23)/p+1 |
| InChIKey | BPGWHKMUDJBGBU-UHFFFAOYSA-O |
| XLogP | 2.75 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|