C23H23Cl2NO6S — CID 3331481
(3,6-dichloro-4-methyl-2-oxochromen-7-yl) 6-[(4-methylphenyl)sulfonylamino]hexanoate (PubChem CID 3331481) has the molecular formula C23H23Cl2NO6S and a molecular weight of 512.41 g/mol. Its IUPAC name is (3,6-dichloro-4-methyl-2-oxochromen-7-yl) 6-[(4-methylphenyl)sulfonylamino]hexanoate.
| Compound Name | (3,6-dichloro-4-methyl-2-oxochromen-7-yl) 6-[(4-methylphenyl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 3331481 |
| Molecular Formula | C23H23Cl2NO6S |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | (3,6-dichloro-4-methyl-2-oxochromen-7-yl) 6-[(4-methylphenyl)sulfonylamino]hexanoate |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCCC(=O)Oc2cc3oc(=O)c(Cl)c(C)c3cc2Cl)cc1 |
| InChI | InChI=1S/C23H23Cl2NO6S/c1-14-7-9-16(10-8-14)33(29,30)26-11-5-3-4-6-21(27)31-20-13-19-17(12-18(20)24)15(2)22(25)23(28)32-19/h7-10,12-13,26H,3-6,11H2,1-2H3 |
| InChIKey | AZXMYNJERIFTMG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|