C27H31NO5 — CID 3345399
[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-oxo-4-(4-propoxyphenyl)butanoate (PubChem CID 3345399) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-oxo-4-(4-propoxyphenyl)butanoate.
| Compound Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-oxo-4-(4-propoxyphenyl)butanoate |
|---|---|
| PubChem CID | 3345399 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-oxo-4-(4-propoxyphenyl)butanoate |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)OCC(=O)C=C2N(C)c3ccccc3C2(C)C)cc1 |
| InChI | InChI=1S/C27H31NO5/c1-5-16-32-21-12-10-19(11-13-21)24(30)14-15-26(31)33-18-20(29)17-25-27(2,3)22-8-6-7-9-23(22)28(25)4/h6-13,17H,5,14-16,18H2,1-4H3 |
| InChIKey | HLKHTWOXIGEAPN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|