C34H43ClN6O4 — CID 3365497
N-[[3-chloro-5-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine (PubChem CID 3365497) has the molecular formula C34H43ClN6O4 and a molecular weight of 635.21 g/mol. Its IUPAC name is N-[[3-chloro-5-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine.
| Compound Name | N-[[3-chloro-5-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 3365497 |
| Molecular Formula | C34H43ClN6O4 |
| Molecular Weight | 635.21 g/mol |
| Exact Mass | 634.30 |
| IUPAC Name | N-[[3-chloro-5-methoxy-4-[2-(2-methoxy-4-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine |
| SMILES | C=CCc1ccc(OCCOc2c(Cl)cc(C=NNc3cc(N4CCCCC4)nc(N4CCCCC4)n3)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C34H43ClN6O4/c1-4-11-25-12-13-28(29(21-25)42-2)44-18-19-45-33-27(35)20-26(22-30(33)43-3)24-36-39-31-23-32(40-14-7-5-8-15-40)38-34(37-31)41-16-9-6-10-17-41/h4,12-13,20-24H,1,5-11,14-19H2,2-3H3,(H,37,38,39) |
| InChIKey | OSQKNHQMEOSMTG-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.21 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|