C27H30ClIN6O4 — CID 4292217
N-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine (PubChem CID 4292217) has the molecular formula C27H30ClIN6O4 and a molecular weight of 664.93 g/mol. Its IUPAC name is N-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 4292217 |
| Molecular Formula | C27H30ClIN6O4 |
| Molecular Weight | 664.93 g/mol |
| Exact Mass | 664.11 |
| IUPAC Name | N-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine |
| SMILES | COc1cc(C=NNc2cc(N3CCOCC3)nc(N3CCOCC3)n2)cc(I)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C27H30ClIN6O4/c1-36-23-15-19(14-22(29)26(23)39-18-20-4-2-3-5-21(20)28)17-30-33-24-16-25(34-6-10-37-11-7-34)32-27(31-24)35-8-12-38-13-9-35/h2-5,14-17H,6-13,18H2,1H3,(H,31,32,33) |
| InChIKey | WQVGYPQBSXRQNM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.93 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|