C29H17Cl3N4O4S2 — CID 3373249
5-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-chloro-N-[3-chloro-4-(1-chloronaphthalen-2-yl)oxyphenyl]benzamide (PubChem CID 3373249) has the molecular formula C29H17Cl3N4O4S2 and a molecular weight of 655.97 g/mol. Its IUPAC name is 5-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-chloro-N-[3-chloro-4-(1-chloronaphthalen-2-yl)oxyphenyl]benzamide.
| Compound Name | 5-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-chloro-N-[3-chloro-4-(1-chloronaphthalen-2-yl)oxyphenyl]benzamide |
|---|---|
| PubChem CID | 3373249 |
| Molecular Formula | C29H17Cl3N4O4S2 |
| Molecular Weight | 655.97 g/mol |
| Exact Mass | 653.98 |
| IUPAC Name | 5-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-chloro-N-[3-chloro-4-(1-chloronaphthalen-2-yl)oxyphenyl]benzamide |
| SMILES | O=C(Nc1ccc(Oc2ccc3ccccc3c2Cl)c(Cl)c1)c1cc(NS(=O)(=O)c2cccc3nsnc23)ccc1Cl |
| InChI | InChI=1S/C29H17Cl3N4O4S2/c30-21-11-9-18(36-42(38,39)26-7-3-6-23-28(26)35-41-34-23)14-20(21)29(37)33-17-10-13-24(22(31)15-17)40-25-12-8-16-4-1-2-5-19(16)27(25)32/h1-15,36H,(H,33,37) |
| InChIKey | HPAZLKRTUJDFNN-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.97 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|