C11H13N5O6 — CID 3412146
N'-(2,4-dinitrophenyl)morpholine-4-carbohydrazide (PubChem CID 3412146) has the molecular formula C11H13N5O6 and a molecular weight of 311.25 g/mol. Its IUPAC name is N'-(2,4-dinitrophenyl)morpholine-4-carbohydrazide.
| Compound Name | N'-(2,4-dinitrophenyl)morpholine-4-carbohydrazide |
|---|---|
| PubChem CID | 3412146 |
| Molecular Formula | C11H13N5O6 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N'-(2,4-dinitrophenyl)morpholine-4-carbohydrazide |
| SMILES | O=C(NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])N1CCOCC1 |
| InChI | InChI=1S/C11H13N5O6/c17-11(14-3-5-22-6-4-14)13-12-9-2-1-8(15(18)19)7-10(9)16(20)21/h1-2,7,12H,3-6H2,(H,13,17) |
| InChIKey | WFPRRPPFLPICLM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|