C17H18N2 — CID 3436833
3,3,10-trimethyl-8-phenyl-7,9-diazatricyclo[4.4.0.02,4]deca-1(10),6,8-triene (PubChem CID 3436833) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3,3,10-trimethyl-8-phenyl-7,9-diazatricyclo[4.4.0.02,4]deca-1(10),6,8-triene.
| Compound Name | 3,3,10-trimethyl-8-phenyl-7,9-diazatricyclo[4.4.0.02,4]deca-1(10),6,8-triene |
|---|---|
| PubChem CID | 3436833 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3,3,10-trimethyl-8-phenyl-7,9-diazatricyclo[4.4.0.02,4]deca-1(10),6,8-triene |
| SMILES | Cc1nc(-c2ccccc2)nc2c1C1C(C2)C1(C)C |
| InChI | InChI=1S/C17H18N2/c1-10-14-13(9-12-15(14)17(12,2)3)19-16(18-10)11-7-5-4-6-8-11/h4-8,12,15H,9H2,1-3H3 |
| InChIKey | VVZNGIWLPQQXHU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |