C21H19N5O2S3 — CID 3454939
4-methyl-N-[2-(2-prop-2-enoxyethylsulfanyl)-1,3-benzothiazol-6-yl]-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 3454939) has the molecular formula C21H19N5O2S3 and a molecular weight of 469.62 g/mol. Its IUPAC name is 4-methyl-N-[2-(2-prop-2-enoxyethylsulfanyl)-1,3-benzothiazol-6-yl]-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[2-(2-prop-2-enoxyethylsulfanyl)-1,3-benzothiazol-6-yl]-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 3454939 |
| Molecular Formula | C21H19N5O2S3 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 4-methyl-N-[2-(2-prop-2-enoxyethylsulfanyl)-1,3-benzothiazol-6-yl]-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | C=CCOCCSc1nc2ccc(NC(=O)c3sc(-c4cnccn4)nc3C)cc2s1 |
| InChI | InChI=1S/C21H19N5O2S3/c1-3-8-28-9-10-29-21-26-15-5-4-14(11-17(15)30-21)25-19(27)18-13(2)24-20(31-18)16-12-22-6-7-23-16/h3-7,11-12H,1,8-10H2,2H3,(H,25,27) |
| InChIKey | XFYSGBXWJVNTHT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|