C23H20N4O6 — CID 3512434
N-[4-[3-(5-methylfuran-2-yl)-1-benzofuran-2-yl]butan-2-ylideneamino]-2,4-dinitroaniline (PubChem CID 3512434) has the molecular formula C23H20N4O6 and a molecular weight of 448.44 g/mol. Its IUPAC name is N-[4-[3-(5-methylfuran-2-yl)-1-benzofuran-2-yl]butan-2-ylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[4-[3-(5-methylfuran-2-yl)-1-benzofuran-2-yl]butan-2-ylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 3512434 |
| Molecular Formula | C23H20N4O6 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-[4-[3-(5-methylfuran-2-yl)-1-benzofuran-2-yl]butan-2-ylideneamino]-2,4-dinitroaniline |
| SMILES | CC(CCc1oc2ccccc2c1-c1ccc(C)o1)=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H20N4O6/c1-14(24-25-18-10-9-16(26(28)29)13-19(18)27(30)31)7-11-22-23(21-12-8-15(2)32-21)17-5-3-4-6-20(17)33-22/h3-6,8-10,12-13,25H,7,11H2,1-2H3 |
| InChIKey | ZJLOVFYQNIAMQS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 136.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|