C38H47N3O3S — CID 3541340
1-benzothiophen-2-yl-[5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 3541340) has the molecular formula C38H47N3O3S and a molecular weight of 625.88 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-[5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | 1-benzothiophen-2-yl-[5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 3541340 |
| Molecular Formula | C38H47N3O3S |
| Molecular Weight | 625.88 g/mol |
| Exact Mass | 625.33 |
| IUPAC Name | 1-benzothiophen-2-yl-[5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4cc5ccccc5s4)=C3)C2CCC2(C)C1CCC2(O)CN1CCCN2CCCN=C21 |
| InChI | InChI=1S/C38H47N3O3S/c1-34-12-9-26(42)22-36(34)15-16-38(27(23-36)32(43)29-21-25-7-3-4-8-28(25)45-29)30(34)10-13-35(2)31(38)11-14-37(35,44)24-41-20-6-19-40-18-5-17-39-33(40)41/h3-4,7-8,15-16,21,23,26,30-31,42,44H,5-6,9-14,17-20,22,24H2,1-2H3 |
| InChIKey | QSYFXJZGWUNXPP-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.88 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|