C22H17ClNO+ — CID 3545915
4-(4-chlorophenyl)-2,6-diphenyl-4H-1,3-oxazin-3-ium (PubChem CID 3545915) has the molecular formula C22H17ClNO+ and a molecular weight of 346.84 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2,6-diphenyl-4H-1,3-oxazin-3-ium.
| Compound Name | 4-(4-chlorophenyl)-2,6-diphenyl-4H-1,3-oxazin-3-ium |
|---|---|
| PubChem CID | 3545915 |
| Molecular Formula | C22H17ClNO+ |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-(4-chlorophenyl)-2,6-diphenyl-4H-1,3-oxazin-3-ium |
| SMILES | Clc1ccc(C2C=C(c3ccccc3)OC(c3ccccc3)=[NH+]2)cc1 |
| InChI | InChI=1S/C22H16ClNO/c23-19-13-11-16(12-14-19)20-15-21(17-7-3-1-4-8-17)25-22(24-20)18-9-5-2-6-10-18/h1-15,20H/p+1 |
| InChIKey | MJJWQDVKRMPXSW-UHFFFAOYSA-O |
| XLogP | 3.98 |
| TPSA | 23.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |