C22H19N3O2S — CID 3594501
4-(1,10b-dihydropyrazolo[1,5-c]quinazolin-5-ylsulfanylmethyl)-7,8-dimethylchromen-2-one (PubChem CID 3594501) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is 4-(1,10b-dihydropyrazolo[1,5-c]quinazolin-5-ylsulfanylmethyl)-7,8-dimethylchromen-2-one.
| Compound Name | 4-(1,10b-dihydropyrazolo[1,5-c]quinazolin-5-ylsulfanylmethyl)-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 3594501 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 4-(1,10b-dihydropyrazolo[1,5-c]quinazolin-5-ylsulfanylmethyl)-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(CSC3=Nc4ccccc4C4CC=NN34)cc(=O)oc2c1C |
| InChI | InChI=1S/C22H19N3O2S/c1-13-7-8-16-15(11-20(26)27-21(16)14(13)2)12-28-22-24-18-6-4-3-5-17(18)19-9-10-23-25(19)22/h3-8,10-11,19H,9,12H2,1-2H3 |
| InChIKey | AWRLWWCCSPRWDZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|