About 2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one
2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one (PubChem CID 3614097) has the molecular formula C8H15NO3S
and a molecular weight of 205.28 g/mol. Its IUPAC name is 2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one |
| PubChem CID | 3614097 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)CSC1C(OC)OC |
| InChI | InChI=1S/C8H15NO3S/c1-4-9-6(10)5-13-7(9)8(11-2)12-3/h7-8H,4-5H2,1-3H3 |
| InChIKey | OLRJITSFRCMJDW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one?
The IUPAC name of 2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one (CID 3614097) is 2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one?
The canonical SMILES for 2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one is CCN1C(=O)CSC1C(OC)OC.
What is the InChIKey of 2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one?
The InChIKey is OLRJITSFRCMJDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3S/c1-4-9-6(10)5-13-7(9)8(11-2)12-3/h7-8H,4-5H2,1-3H3.
What are the key properties of 2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one?
2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one has a molecular weight of 205.28 g/mol, XLogP of 0.53, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethoxymethyl)-3-ethyl-1,3-thiazolidin-4-one is sourced from PubChem (CID 3614097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).