C28H32N2O7 — CID 3628832
[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate (PubChem CID 3628832) has the molecular formula C28H32N2O7 and a molecular weight of 508.57 g/mol. Its IUPAC name is [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate.
| Compound Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 3628832 |
| Molecular Formula | C28H32N2O7 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate |
| SMILES | COc1cc(C(=O)OCC(=O)C=C2N(C)c3ccccc3C2(C)C)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C28H32N2O7/c1-28(2)21-7-5-6-8-22(21)29(3)25(28)16-20(31)17-37-27(33)19-9-10-23(24(15-19)34-4)36-18-26(32)30-11-13-35-14-12-30/h5-10,15-16H,11-14,17-18H2,1-4H3 |
| InChIKey | NYFAHAWDSBFYJY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|