C21H15N3O5S — CID 36658805
2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-4-thiophen-2-ylphthalazin-1-one (PubChem CID 36658805) has the molecular formula C21H15N3O5S and a molecular weight of 421.43 g/mol. Its IUPAC name is 2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-4-thiophen-2-ylphthalazin-1-one.
| Compound Name | 2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-4-thiophen-2-ylphthalazin-1-one |
|---|---|
| PubChem CID | 36658805 |
| Molecular Formula | C21H15N3O5S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-4-thiophen-2-ylphthalazin-1-one |
| SMILES | O=c1c2ccccc2c(-c2cccs2)nn1Cc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C21H15N3O5S/c25-21-17-5-2-1-4-16(17)19(18-6-3-7-30-18)22-23(21)10-13-8-15(24(26)27)9-14-11-28-12-29-20(13)14/h1-9H,10-12H2 |
| InChIKey | PYJWRTDZZKQUKG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|