C34H23BrN2O6 — CID 3665889
[2-(2-hydroxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-8-ethylquinoline-4-carboxylate (PubChem CID 3665889) has the molecular formula C34H23BrN2O6 and a molecular weight of 635.47 g/mol. Its IUPAC name is [2-(2-hydroxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-8-ethylquinoline-4-carboxylate.
| Compound Name | [2-(2-hydroxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-8-ethylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 3665889 |
| Molecular Formula | C34H23BrN2O6 |
| Molecular Weight | 635.47 g/mol |
| Exact Mass | 634.07 |
| IUPAC Name | [2-(2-hydroxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-8-ethylquinoline-4-carboxylate |
| SMILES | CCc1cc(Br)cc2c(C(=O)OCC(=O)c3ccccc3O)cc(-c3ccc(N4C(=O)c5ccccc5C4=O)cc3)nc12 |
| InChI | InChI=1S/C34H23BrN2O6/c1-2-19-15-21(35)16-26-27(34(42)43-18-30(39)25-9-5-6-10-29(25)38)17-28(36-31(19)26)20-11-13-22(14-12-20)37-32(40)23-7-3-4-8-24(23)33(37)41/h3-17,38H,2,18H2,1H3 |
| InChIKey | VDFCADRJLOFIDM-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.47 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|