C27H25BrN2O4 — CID 3473184
6-bromo-8-ethyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylic acid (PubChem CID 3473184) has the molecular formula C27H25BrN2O4 and a molecular weight of 521.41 g/mol. Its IUPAC name is 6-bromo-8-ethyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylic acid.
| Compound Name | 6-bromo-8-ethyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3473184 |
| Molecular Formula | C27H25BrN2O4 |
| Molecular Weight | 521.41 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | 6-bromo-8-ethyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylic acid |
| SMILES | CCc1cc(Br)cc2c(C(=O)O)cc(-c3ccc(N4C(=O)C5CCC(C)CC5C4=O)cc3)nc12 |
| InChI | InChI=1S/C27H25BrN2O4/c1-3-15-11-17(28)12-20-22(27(33)34)13-23(29-24(15)20)16-5-7-18(8-6-16)30-25(31)19-9-4-14(2)10-21(19)26(30)32/h5-8,11-14,19,21H,3-4,9-10H2,1-2H3,(H,33,34) |
| InChIKey | OJDLZBHIMWJWKW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.41 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|