C17H27N5O3 — CID 3731335
N-(cyclopropylmethyl)-6-(2,6-dimethylmorpholin-4-yl)-5-nitro-N-propylpyrimidin-4-amine (PubChem CID 3731335) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-6-(2,6-dimethylmorpholin-4-yl)-5-nitro-N-propylpyrimidin-4-amine.
| Compound Name | N-(cyclopropylmethyl)-6-(2,6-dimethylmorpholin-4-yl)-5-nitro-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 3731335 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | N-(cyclopropylmethyl)-6-(2,6-dimethylmorpholin-4-yl)-5-nitro-N-propylpyrimidin-4-amine |
| SMILES | CCCN(CC1CC1)c1ncnc(N2CC(C)OC(C)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H27N5O3/c1-4-7-20(10-14-5-6-14)16-15(22(23)24)17(19-11-18-16)21-8-12(2)25-13(3)9-21/h11-14H,4-10H2,1-3H3 |
| InChIKey | HAXCHJXWPAVNBP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|