C11H9ClN2O2S2 — CID 3804960
4-(1H-benzimidazol-2-ylsulfanyl)-3-chloro-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 3804960) has the molecular formula C11H9ClN2O2S2 and a molecular weight of 300.79 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanyl)-3-chloro-2,3-dihydrothiophene 1,1-dioxide.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanyl)-3-chloro-2,3-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 3804960 |
| Molecular Formula | C11H9ClN2O2S2 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanyl)-3-chloro-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C=C(Sc2nc3ccccc3[nH]2)C(Cl)C1 |
| InChI | InChI=1S/C11H9ClN2O2S2/c12-7-5-18(15,16)6-10(7)17-11-13-8-3-1-2-4-9(8)14-11/h1-4,6-7H,5H2,(H,13,14) |
| InChIKey | ZXTFHBBGHQBIDC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|