C20H21Cl3N2O4 — CID 3809971
5-cyclohexyl-3-methyl-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3809971) has the molecular formula C20H21Cl3N2O4 and a molecular weight of 459.76 g/mol. Its IUPAC name is 5-cyclohexyl-3-methyl-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-cyclohexyl-3-methyl-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3809971 |
| Molecular Formula | C20H21Cl3N2O4 |
| Molecular Weight | 459.76 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 5-cyclohexyl-3-methyl-4,6-dioxo-1-(2,3,5-trichlorophenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC1(C(=O)O)NC(c2cc(Cl)cc(Cl)c2Cl)C2C(=O)N(C3CCCCC3)C(=O)C21 |
| InChI | InChI=1S/C20H21Cl3N2O4/c1-20(19(28)29)14-13(16(24-20)11-7-9(21)8-12(22)15(11)23)17(26)25(18(14)27)10-5-3-2-4-6-10/h7-8,10,13-14,16,24H,2-6H2,1H3,(H,28,29) |
| InChIKey | RKAIVVWDBHTESR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.76 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|