C20H15ClN4O4S — CID 3854508
2-(4-chlorophenyl)imino-5-(1,7-dimethyl-5-nitro-2-oxoindol-3-ylidene)-3-methyl-1,3-thiazolidin-4-one (PubChem CID 3854508) has the molecular formula C20H15ClN4O4S and a molecular weight of 442.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)imino-5-(1,7-dimethyl-5-nitro-2-oxoindol-3-ylidene)-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-chlorophenyl)imino-5-(1,7-dimethyl-5-nitro-2-oxoindol-3-ylidene)-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3854508 |
| Molecular Formula | C20H15ClN4O4S |
| Molecular Weight | 442.88 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 2-(4-chlorophenyl)imino-5-(1,7-dimethyl-5-nitro-2-oxoindol-3-ylidene)-3-methyl-1,3-thiazolidin-4-one |
| SMILES | Cc1cc([N+](=O)[O-])cc2c1N(C)C(=O)C2=C1S/C(=N/c2ccc(Cl)cc2)N(C)C1=O |
| InChI | InChI=1S/C20H15ClN4O4S/c1-10-8-13(25(28)29)9-14-15(18(26)23(2)16(10)14)17-19(27)24(3)20(30-17)22-12-6-4-11(21)5-7-12/h4-9H,1-3H3/b17-15?,22-20+ |
| InChIKey | UQZSSVAUMPUFDB-YVEIWAIBSA-N |
| XLogP | 4.14 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.88 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|