C29H26N4O4S — CID 56687697
(5E)-3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-5-(1-ethyl-5-nitro-2-oxoindol-3-ylidene)-1,3-thiazolidin-4-one (PubChem CID 56687697) has the molecular formula C29H26N4O4S and a molecular weight of 526.62 g/mol. Its IUPAC name is (5E)-3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-5-(1-ethyl-5-nitro-2-oxoindol-3-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-5-(1-ethyl-5-nitro-2-oxoindol-3-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 56687697 |
| Molecular Formula | C29H26N4O4S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | (5E)-3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-5-(1-ethyl-5-nitro-2-oxoindol-3-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C2/S/C(=N\c3ccc(C)c(C)c3)N(c3ccc(C)c(C)c3)C2=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C29H26N4O4S/c1-6-31-24-12-11-22(33(36)37)15-23(24)25(27(31)34)26-28(35)32(21-10-8-17(3)19(5)14-21)29(38-26)30-20-9-7-16(2)18(4)13-20/h7-15H,6H2,1-5H3/b26-25+,30-29- |
| InChIKey | IYUYDVXZUQOKCV-AUMNFMOHSA-N |
| XLogP | 6.37 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|