C16H18N2O2S — CID 39160357
2-[4-(piperidin-1-ium-1-ylmethyl)phenyl]-1,3-thiazole-4-carboxylate (PubChem CID 39160357) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-[4-(piperidin-1-ium-1-ylmethyl)phenyl]-1,3-thiazole-4-carboxylate.
| Compound Name | 2-[4-(piperidin-1-ium-1-ylmethyl)phenyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 39160357 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[4-(piperidin-1-ium-1-ylmethyl)phenyl]-1,3-thiazole-4-carboxylate |
| SMILES | O=C([O-])c1csc(-c2ccc(C[NH+]3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C16H18N2O2S/c19-16(20)14-11-21-15(17-14)13-6-4-12(5-7-13)10-18-8-2-1-3-9-18/h4-7,11H,1-3,8-10H2,(H,19,20) |
| InChIKey | VGCFGDRSSXRTFH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 57.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |