C16H24ClN3O2S — CID 3990078
N,N-dibutyl-5-chloro-3-cyano-4,6-dimethylpyridine-2-sulfonamide (PubChem CID 3990078) has the molecular formula C16H24ClN3O2S and a molecular weight of 357.91 g/mol. Its IUPAC name is N,N-dibutyl-5-chloro-3-cyano-4,6-dimethylpyridine-2-sulfonamide.
| Compound Name | N,N-dibutyl-5-chloro-3-cyano-4,6-dimethylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 3990078 |
| Molecular Formula | C16H24ClN3O2S |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N,N-dibutyl-5-chloro-3-cyano-4,6-dimethylpyridine-2-sulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1nc(C)c(Cl)c(C)c1C#N |
| InChI | InChI=1S/C16H24ClN3O2S/c1-5-7-9-20(10-8-6-2)23(21,22)16-14(11-18)12(3)15(17)13(4)19-16/h5-10H2,1-4H3 |
| InChIKey | MYCJHYBHXQAKBJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |