C18H20N6S2 — CID 4016392
1-(3,4-dihydro-2H-quinoline-1-carbothioylamino)-3-(1-pyridin-2-ylethylideneamino)thiourea (PubChem CID 4016392) has the molecular formula C18H20N6S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinoline-1-carbothioylamino)-3-(1-pyridin-2-ylethylideneamino)thiourea.
| Compound Name | 1-(3,4-dihydro-2H-quinoline-1-carbothioylamino)-3-(1-pyridin-2-ylethylideneamino)thiourea |
|---|---|
| PubChem CID | 4016392 |
| Molecular Formula | C18H20N6S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinoline-1-carbothioylamino)-3-(1-pyridin-2-ylethylideneamino)thiourea |
| SMILES | CC(=NNC(=S)NNC(=S)N1CCCc2ccccc21)c1ccccn1 |
| InChI | InChI=1S/C18H20N6S2/c1-13(15-9-4-5-11-19-15)20-21-17(25)22-23-18(26)24-12-6-8-14-7-2-3-10-16(14)24/h2-5,7,9-11H,6,8,12H2,1H3,(H,23,26)(H2,21,22,25) |
| InChIKey | JNBOUSQWJHRUDU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|