C29H29NO4S — CID 4027929
[2-(cyclooctylamino)-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate (PubChem CID 4027929) has the molecular formula C29H29NO4S and a molecular weight of 487.62 g/mol. Its IUPAC name is [2-(cyclooctylamino)-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate.
| Compound Name | [2-(cyclooctylamino)-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate |
|---|---|
| PubChem CID | 4027929 |
| Molecular Formula | C29H29NO4S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | [2-(cyclooctylamino)-2-oxoethyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSc1ccc2c3c(cccc13)C(=O)c1ccccc1-2)NC1CCCCCCC1 |
| InChI | InChI=1S/C29H29NO4S/c31-26(30-19-9-4-2-1-3-5-10-19)17-34-27(32)18-35-25-16-15-21-20-11-6-7-12-22(20)29(33)24-14-8-13-23(25)28(21)24/h6-8,11-16,19H,1-5,9-10,17-18H2,(H,30,31) |
| InChIKey | VLQRCLPTGVNJGW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |