C21H15NO4S — CID 4689514
(2-amino-2-oxoethyl) 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate (PubChem CID 4689514) has the molecular formula C21H15NO4S and a molecular weight of 377.42 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate.
| Compound Name | (2-amino-2-oxoethyl) 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate |
|---|---|
| PubChem CID | 4689514 |
| Molecular Formula | C21H15NO4S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate |
| SMILES | NC(=O)COC(=O)CSc1ccc2c3c(cccc13)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C21H15NO4S/c22-18(23)10-26-19(24)11-27-17-9-8-13-12-4-1-2-5-14(12)21(25)16-7-3-6-15(17)20(13)16/h1-9H,10-11H2,(H2,22,23) |
| InChIKey | RAPAJVCYXGOMOU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |