C25H18N2O4S — CID 98569177
[(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate (PubChem CID 98569177) has the molecular formula C25H18N2O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate.
| Compound Name | [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate |
|---|---|
| PubChem CID | 98569177 |
| Molecular Formula | C25H18N2O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | [(Z)-4-amino-3-cyano-2-oxopent-3-enyl] 2-(7-oxobenzo[a]phenalen-3-yl)sulfanylacetate |
| SMILES | C/C(N)=C(\C#N)C(=O)COC(=O)CSc1ccc2c3c(cccc13)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C25H18N2O4S/c1-14(27)20(11-26)21(28)12-31-23(29)13-32-22-10-9-16-15-5-2-3-6-17(15)25(30)19-8-4-7-18(22)24(16)19/h2-10H,12-13,27H2,1H3/b20-14- |
| InChIKey | IKPFMMOKYKZFBK-ZHZULCJRSA-N |
| XLogP | 4.01 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|